C18H30FN3O2S — CID 139937499
N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-fluorobenzenesulfonamide (PubChem CID 139937499) has the molecular formula C18H30FN3O2S and a molecular weight of 371.52 g/mol. Its IUPAC name is N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 139937499 |
| Molecular Formula | C18H30FN3O2S |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCCNCCNC1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H30FN3O2S/c19-16-8-10-18(11-9-16)25(23,24)22-13-5-4-12-20-14-15-21-17-6-2-1-3-7-17/h8-11,17,20-22H,1-7,12-15H2 |
| InChIKey | GGXFAYSVUZKWTK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|