C19H33N3O3S — CID 139937566
N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-methoxybenzenesulfonamide (PubChem CID 139937566) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 139937566 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCCNCCNC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H33N3O3S/c1-25-18-9-11-19(12-10-18)26(23,24)22-14-6-5-13-20-15-16-21-17-7-3-2-4-8-17/h9-12,17,20-22H,2-8,13-16H2,1H3 |
| InChIKey | SHYAVTFLIYPMLP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|