C19H33ClN2O4S — CID 119987301
N-[2-(cycloheptylamino)ethyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride (PubChem CID 119987301) has the molecular formula C19H33ClN2O4S and a molecular weight of 421.00 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119987301 |
| Molecular Formula | C19H33ClN2O4S |
| Molecular Weight | 421.00 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride |
| SMILES | CCOCCOc1ccc(S(=O)(=O)NCCNC2CCCCCC2)cc1.Cl |
| InChI | InChI=1S/C19H32N2O4S.ClH/c1-2-24-15-16-25-18-9-11-19(12-10-18)26(22,23)21-14-13-20-17-7-5-3-4-6-8-17;/h9-12,17,20-21H,2-8,13-16H2,1H3;1H |
| InChIKey | XJAGGNYXVHZSEH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.00 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|