C16H27ClN2O4S — CID 119985886
N-[2-(aminomethyl)cyclopentyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride (PubChem CID 119985886) has the molecular formula C16H27ClN2O4S and a molecular weight of 378.92 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119985886 |
| Molecular Formula | C16H27ClN2O4S |
| Molecular Weight | 378.92 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-ethoxyethoxy)benzenesulfonamide;hydrochloride |
| SMILES | CCOCCOc1ccc(S(=O)(=O)NC2CCCC2CN)cc1.Cl |
| InChI | InChI=1S/C16H26N2O4S.ClH/c1-2-21-10-11-22-14-6-8-15(9-7-14)23(19,20)18-16-5-3-4-13(16)12-17;/h6-9,13,16,18H,2-5,10-12,17H2,1H3;1H |
| InChIKey | IFZHPPRWVPJGCD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.92 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|