C23H37Cl2N3O2S — CID 139937731
N-[4-[(3-amino-3-cyclohexylpropyl)amino]butyl]naphthalene-2-sulfonamide;dihydrochloride (PubChem CID 139937731) has the molecular formula C23H37Cl2N3O2S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-[4-[(3-amino-3-cyclohexylpropyl)amino]butyl]naphthalene-2-sulfonamide;dihydrochloride.
| Compound Name | N-[4-[(3-amino-3-cyclohexylpropyl)amino]butyl]naphthalene-2-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 139937731 |
| Molecular Formula | C23H37Cl2N3O2S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N-[4-[(3-amino-3-cyclohexylpropyl)amino]butyl]naphthalene-2-sulfonamide;dihydrochloride |
| SMILES | Cl.Cl.NC(CCNCCCCNS(=O)(=O)c1ccc2ccccc2c1)C1CCCCC1 |
| InChI | InChI=1S/C23H35N3O2S.2ClH/c24-23(20-9-2-1-3-10-20)14-17-25-15-6-7-16-26-29(27,28)22-13-12-19-8-4-5-11-21(19)18-22;;/h4-5,8,11-13,18,20,23,25-26H,1-3,6-7,9-10,14-17,24H2;2*1H |
| InChIKey | NBYCBENBRAJGQU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|