C14H19NO4S — CID 43389822
N-(4-hydroxycyclohexyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 43389822) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(4-hydroxycyclohexyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 43389822 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCC(O)CC1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H19NO4S/c16-12-3-1-11(2-4-12)15-20(17,18)13-5-6-14-10(9-13)7-8-19-14/h5-6,9,11-12,15-16H,1-4,7-8H2 |
| InChIKey | MRKORQCICKVNMT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |