C13H16FNO3S — CID 126857791
N-(2-fluorocyclopentyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 126857791) has the molecular formula C13H16FNO3S and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(2-fluorocyclopentyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(2-fluorocyclopentyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 126857791 |
| Molecular Formula | C13H16FNO3S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-(2-fluorocyclopentyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1F)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C13H16FNO3S/c14-11-2-1-3-12(11)15-19(16,17)10-4-5-13-9(8-10)6-7-18-13/h4-5,8,11-12,15H,1-3,6-7H2 |
| InChIKey | MLVXRVYHOJEQNP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |