C13H16N2O3S — CID 71875688
7-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 71875688) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 7-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 7-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 71875688 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 7-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2ccc(S(=O)(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C13H16N2O3S/c16-13-12-9-11(4-3-10(12)5-6-14-13)19(17,18)15-7-1-2-8-15/h3-4,9H,1-2,5-8H2,(H,14,16) |
| InChIKey | OEPAVEVUGMFKRL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |