C14H17N3O4S — CID 18422443
7-piperidin-1-ylsulfonyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 18422443) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 7-piperidin-1-ylsulfonyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 7-piperidin-1-ylsulfonyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 18422443 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 7-piperidin-1-ylsulfonyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1CNC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2N1 |
| InChI | InChI=1S/C14H17N3O4S/c18-13-9-15-14(19)11-8-10(4-5-12(11)16-13)22(20,21)17-6-2-1-3-7-17/h4-5,8H,1-3,6-7,9H2,(H,15,19)(H,16,18) |
| InChIKey | MOMXLTAVTLPKDR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |