C12H15N3O4S — CID 156842363
molecular hydrogen;5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione (PubChem CID 156842363) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is molecular hydrogen;5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione.
| Compound Name | molecular hydrogen;5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 156842363 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | molecular hydrogen;5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccc(S(=O)(=O)N3CCNCC3)cc2C1=O.[H][H] |
| InChI | InChI=1S/C12H13N3O4S.H2/c16-11-9-7-8(1-2-10(9)14-12(11)17)20(18,19)15-5-3-13-4-6-15;/h1-2,7,13H,3-6H2,(H,14,16,17);1H |
| InChIKey | WHSOQZBZZAVNPK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|