C20H18ClN3O6S — CID 175455542
5-[4-[2-(2-chlorophenoxy)acetyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione (PubChem CID 175455542) has the molecular formula C20H18ClN3O6S and a molecular weight of 463.90 g/mol. Its IUPAC name is 5-[4-[2-(2-chlorophenoxy)acetyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione.
| Compound Name | 5-[4-[2-(2-chlorophenoxy)acetyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 175455542 |
| Molecular Formula | C20H18ClN3O6S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 5-[4-[2-(2-chlorophenoxy)acetyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccc(S(=O)(=O)N3CCN(C(=O)COc4ccccc4Cl)CC3)cc2C1=O |
| InChI | InChI=1S/C20H18ClN3O6S/c21-15-3-1-2-4-17(15)30-12-18(25)23-7-9-24(10-8-23)31(28,29)13-5-6-16-14(11-13)19(26)20(27)22-16/h1-6,11H,7-10,12H2,(H,22,26,27) |
| InChIKey | HAIZVVXIUROQIK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|