C14H14F3N3O6S — CID 175455244
5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione;2,2,2-trifluoroacetic acid (PubChem CID 175455244) has the molecular formula C14H14F3N3O6S and a molecular weight of 409.34 g/mol. Its IUPAC name is 5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175455244 |
| Molecular Formula | C14H14F3N3O6S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 5-piperazin-1-ylsulfonyl-1H-indole-2,3-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1Nc2ccc(S(=O)(=O)N3CCNCC3)cc2C1=O |
| InChI | InChI=1S/C12H13N3O4S.C2HF3O2/c16-11-9-7-8(1-2-10(9)14-12(11)17)20(18,19)15-5-3-13-4-6-15;3-2(4,5)1(6)7/h1-2,7,13H,3-6H2,(H,14,16,17);(H,6,7) |
| InChIKey | XDUOZCZYLNMWKT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|