C20H20BrN3O5S — CID 175455268
5-[4-[2-(4-bromophenoxy)ethyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione (PubChem CID 175455268) has the molecular formula C20H20BrN3O5S and a molecular weight of 494.37 g/mol. Its IUPAC name is 5-[4-[2-(4-bromophenoxy)ethyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione.
| Compound Name | 5-[4-[2-(4-bromophenoxy)ethyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 175455268 |
| Molecular Formula | C20H20BrN3O5S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 5-[4-[2-(4-bromophenoxy)ethyl]piperazin-1-yl]sulfonyl-1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccc(S(=O)(=O)N3CCN(CCOc4ccc(Br)cc4)CC3)cc2C1=O |
| InChI | InChI=1S/C20H20BrN3O5S/c21-14-1-3-15(4-2-14)29-12-11-23-7-9-24(10-8-23)30(27,28)16-5-6-18-17(13-16)19(25)20(26)22-18/h1-6,13H,7-12H2,(H,22,25,26) |
| InChIKey | BIZDHPVMQYDXKK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|