C8H6ClNO5S — CID 87793086
2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride (PubChem CID 87793086) has the molecular formula C8H6ClNO5S and a molecular weight of 263.66 g/mol. Its IUPAC name is 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride.
| Compound Name | 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 87793086 |
| Molecular Formula | C8H6ClNO5S |
| Molecular Weight | 263.66 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride |
| SMILES | Cl.O=C1Nc2ccc(S(=O)(=O)O)cc2C1=O |
| InChI | InChI=1S/C8H5NO5S.ClH/c10-7-5-3-4(15(12,13)14)1-2-6(5)9-8(7)11;/h1-3H,(H,9,10,11)(H,12,13,14);1H |
| InChIKey | PXAGFJUXZQNCIC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.66 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|