2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride

C8H6ClNO5S — CID 87793086

IUPAC2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride
SMILESCl.O=C1Nc2ccc(S(=O)(=O)O)cc2C1=O
InChIInChI=1S/C8H5NO5S.ClH/c10-7-5-3-4(15(12,13)14)1-2-6(5)9-8(7)11;/h1-3H,(H,9,10,11)(H,12,13,14);1H
InChIKeyPXAGFJUXZQNCIC-UHFFFAOYSA-N
MW263.66 g/mol
LogP0.49
Rot. Bonds1

About 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride

2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride (PubChem CID 87793086) has the molecular formula C8H6ClNO5S and a molecular weight of 263.66 g/mol. Its IUPAC name is 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride.

Molecular Properties

Compound Name2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride
PubChem CID87793086
Molecular FormulaC8H6ClNO5S
Molecular Weight263.66 g/mol
Exact Mass262.97
IUPAC Name2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride
SMILESCl.O=C1Nc2ccc(S(=O)(=O)O)cc2C1=O
InChIInChI=1S/C8H5NO5S.ClH/c10-7-5-3-4(15(12,13)14)1-2-6(5)9-8(7)11;/h1-3H,(H,9,10,11)(H,12,13,14);1H
InChIKeyPXAGFJUXZQNCIC-UHFFFAOYSA-N
XLogP0.49
TPSA100.54 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.66
LogP ≤ 50.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride?
The IUPAC name of 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride (CID 87793086) is 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride.
What is the SMILES notation for 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride?
The canonical SMILES for 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride is Cl.O=C1Nc2ccc(S(=O)(=O)O)cc2C1=O.
What is the InChIKey of 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride?
The InChIKey is PXAGFJUXZQNCIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO5S.ClH/c10-7-5-3-4(15(12,13)14)1-2-6(5)9-8(7)11;/h1-3H,(H,9,10,11)(H,12,13,14);1H.
What are the key properties of 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride?
2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride has a molecular weight of 263.66 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dioxo-1H-indole-5-sulfonic acid;hydrochloride is sourced from PubChem (CID 87793086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).