C8H7ClN2O2 — CID 133055116
5-amino-1H-indole-2,3-dione;hydrochloride (PubChem CID 133055116) has the molecular formula C8H7ClN2O2 and a molecular weight of 198.61 g/mol. Its IUPAC name is 5-amino-1H-indole-2,3-dione;hydrochloride.
| Compound Name | 5-amino-1H-indole-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 133055116 |
| Molecular Formula | C8H7ClN2O2 |
| Molecular Weight | 198.61 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 5-amino-1H-indole-2,3-dione;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C8H6N2O2.ClH/c9-4-1-2-6-5(3-4)7(11)8(12)10-6;/h1-3H,9H2,(H,10,11,12);1H |
| InChIKey | CWEHYENWEHAPAN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.61 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|