About 5-bromo-1H-indole-2,3-dione;methane
5-bromo-1H-indole-2,3-dione;methane (PubChem CID 175094676) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is 5-bromo-1H-indole-2,3-dione;methane.
Molecular Properties
| Compound Name | 5-bromo-1H-indole-2,3-dione;methane |
| PubChem CID | 175094676 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 5-bromo-1H-indole-2,3-dione;methane |
| SMILES | C.O=C1Nc2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C8H4BrNO2.CH4/c9-4-1-2-6-5(3-4)7(11)8(12)10-6;/h1-3H,(H,10,11,12);1H4 |
| InChIKey | JUSYXGWEMTVPDK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1H-indole-2,3-dione;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-indole-2,3-dione;methane?
The IUPAC name of 5-bromo-1H-indole-2,3-dione;methane (CID 175094676) is 5-bromo-1H-indole-2,3-dione;methane.
What is the SMILES notation for 5-bromo-1H-indole-2,3-dione;methane?
The canonical SMILES for 5-bromo-1H-indole-2,3-dione;methane is C.O=C1Nc2ccc(Br)cc2C1=O.
What is the InChIKey of 5-bromo-1H-indole-2,3-dione;methane?
The InChIKey is JUSYXGWEMTVPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrNO2.CH4/c9-4-1-2-6-5(3-4)7(11)8(12)10-6;/h1-3H,(H,10,11,12);1H4.
What are the key properties of 5-bromo-1H-indole-2,3-dione;methane?
5-bromo-1H-indole-2,3-dione;methane has a molecular weight of 242.07 g/mol, XLogP of 2.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-indole-2,3-dione;methane is sourced from PubChem (CID 175094676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).