C13H19NO2 — CID 167465051
ethane;5-methyl-1H-indole-2,3-dione (PubChem CID 167465051) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is ethane;5-methyl-1H-indole-2,3-dione.
| Compound Name | ethane;5-methyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 167465051 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethane;5-methyl-1H-indole-2,3-dione |
| SMILES | CC.CC.Cc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C9H7NO2.2C2H6/c1-5-2-3-7-6(4-5)8(11)9(12)10-7;2*1-2/h2-4H,1H3,(H,10,11,12);2*1-2H3 |
| InChIKey | KFZPMUGKLUGOTJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|