C24H22Cl2N2O2 — CID 90696873
6,13-dichloro-2,9-dimethyl-5,5a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione;ethane (PubChem CID 90696873) has the molecular formula C24H22Cl2N2O2 and a molecular weight of 441.36 g/mol. Its IUPAC name is 6,13-dichloro-2,9-dimethyl-5,5a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione;ethane.
| Compound Name | 6,13-dichloro-2,9-dimethyl-5,5a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione;ethane |
|---|---|
| PubChem CID | 90696873 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 6,13-dichloro-2,9-dimethyl-5,5a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione;ethane |
| SMILES | CC.Cc1ccc2c(c1)C(=O)C1=C(Cl)C3Nc4ccc(C)cc4C(=O)C3=C(Cl)C1N2 |
| InChI | InChI=1S/C22H16Cl2N2O2.C2H6/c1-9-3-5-13-11(7-9)21(27)15-17(23)20-16(18(24)19(15)25-13)22(28)12-8-10(2)4-6-14(12)26-20;1-2/h3-8,19-20,25-26H,1-2H3;1-2H3 |
| InChIKey | KNHWTJIFQPNKEQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |