C10H11NO2 — CID 121370933
2,6-dimethyl-1,2-dihydro-3,1-benzoxazin-4-one (PubChem CID 121370933) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2,6-dimethyl-1,2-dihydro-3,1-benzoxazin-4-one.
| Compound Name | 2,6-dimethyl-1,2-dihydro-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 121370933 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2,6-dimethyl-1,2-dihydro-3,1-benzoxazin-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)OC(C)N2 |
| InChI | InChI=1S/C10H11NO2/c1-6-3-4-9-8(5-6)10(12)13-7(2)11-9/h3-5,7,11H,1-2H3 |
| InChIKey | FWSBLTTVRFRBHP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |