C13H16O2 — CID 132563219
(3S,4S)-3-ethyl-4,7-dimethyl-3,4-dihydroisochromen-1-one (PubChem CID 132563219) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (3S,4S)-3-ethyl-4,7-dimethyl-3,4-dihydroisochromen-1-one.
| Compound Name | (3S,4S)-3-ethyl-4,7-dimethyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 132563219 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3S,4S)-3-ethyl-4,7-dimethyl-3,4-dihydroisochromen-1-one |
| SMILES | CC[C@@H]1OC(=O)c2cc(C)ccc2[C@@H]1C |
| InChI | InChI=1S/C13H16O2/c1-4-12-9(3)10-6-5-8(2)7-11(10)13(14)15-12/h5-7,9,12H,4H2,1-3H3/t9-,12-/m0/s1 |
| InChIKey | ZUEVIMJDDNKSFV-CABZTGNLSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |