C10H10OS — CID 122484836
3,6-dimethyl-3H-2-benzothiophen-1-one (PubChem CID 122484836) has the molecular formula C10H10OS and a molecular weight of 178.26 g/mol. Its IUPAC name is 3,6-dimethyl-3H-2-benzothiophen-1-one.
| Compound Name | 3,6-dimethyl-3H-2-benzothiophen-1-one |
|---|---|
| PubChem CID | 122484836 |
| Molecular Formula | C10H10OS |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3,6-dimethyl-3H-2-benzothiophen-1-one |
| SMILES | Cc1ccc2c(c1)C(=O)SC2C |
| InChI | InChI=1S/C10H10OS/c1-6-3-4-8-7(2)12-10(11)9(8)5-6/h3-5,7H,1-2H3 |
| InChIKey | VRABTXLFAPEFMF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|