C12H12O — CID 130031161
3,5-dimethyl-2-methylidene-3H-inden-1-one (PubChem CID 130031161) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 3,5-dimethyl-2-methylidene-3H-inden-1-one.
| Compound Name | 3,5-dimethyl-2-methylidene-3H-inden-1-one |
|---|---|
| PubChem CID | 130031161 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 3,5-dimethyl-2-methylidene-3H-inden-1-one |
| SMILES | C=C1C(=O)c2ccc(C)cc2C1C |
| InChI | InChI=1S/C12H12O/c1-7-4-5-10-11(6-7)8(2)9(3)12(10)13/h4-6,8H,3H2,1-2H3 |
| InChIKey | RVRDTSOPUFJGCJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|