C11H12O — CID 126604553
2,5-dimethyl-3-methylidene-1-benzofuran (PubChem CID 126604553) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 2,5-dimethyl-3-methylidene-1-benzofuran.
| Compound Name | 2,5-dimethyl-3-methylidene-1-benzofuran |
|---|---|
| PubChem CID | 126604553 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2,5-dimethyl-3-methylidene-1-benzofuran |
| SMILES | C=C1c2cc(C)ccc2OC1C |
| InChI | InChI=1S/C11H12O/c1-7-4-5-11-10(6-7)8(2)9(3)12-11/h4-6,9H,2H2,1,3H3 |
| InChIKey | GIVYHAWRWHWDRA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |