C10H10ClNO — CID 82363801
3-chloro-2,7-dimethyl-2H-1,4-benzoxazine (PubChem CID 82363801) has the molecular formula C10H10ClNO and a molecular weight of 195.65 g/mol. Its IUPAC name is 3-chloro-2,7-dimethyl-2H-1,4-benzoxazine.
| Compound Name | 3-chloro-2,7-dimethyl-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 82363801 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-chloro-2,7-dimethyl-2H-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)OC(C)C(Cl)=N2 |
| InChI | InChI=1S/C10H10ClNO/c1-6-3-4-8-9(5-6)13-7(2)10(11)12-8/h3-5,7H,1-2H3 |
| InChIKey | VYDOTRZMFKSNAQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |