C11H12ClN — CID 163716557
2-chloro-3,3,5-trimethylindole (PubChem CID 163716557) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 2-chloro-3,3,5-trimethylindole.
| Compound Name | 2-chloro-3,3,5-trimethylindole |
|---|---|
| PubChem CID | 163716557 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-chloro-3,3,5-trimethylindole |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(Cl)=N2 |
| InChI | InChI=1S/C11H12ClN/c1-7-4-5-9-8(6-7)11(2,3)10(12)13-9/h4-6H,1-3H3 |
| InChIKey | KNWOEBIRWYISIQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |