C13H20N+ — CID 59439851
2,2,3,3,5-pentamethyl-1H-isoindol-2-ium (PubChem CID 59439851) has the molecular formula C13H20N+ and a molecular weight of 190.31 g/mol. Its IUPAC name is 2,2,3,3,5-pentamethyl-1H-isoindol-2-ium.
| Compound Name | 2,2,3,3,5-pentamethyl-1H-isoindol-2-ium |
|---|---|
| PubChem CID | 59439851 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 2,2,3,3,5-pentamethyl-1H-isoindol-2-ium |
| SMILES | Cc1ccc2c(c1)C(C)(C)[N+](C)(C)C2 |
| InChI | InChI=1S/C13H20N/c1-10-6-7-11-9-14(4,5)13(2,3)12(11)8-10/h6-8H,9H2,1-5H3/q+1 |
| InChIKey | DDYORXDQPIDWKF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|