C14H20 — CID 169145342
3,5-dimethyl-3-propan-2-yl-1,2-dihydroindene (PubChem CID 169145342) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 3,5-dimethyl-3-propan-2-yl-1,2-dihydroindene.
| Compound Name | 3,5-dimethyl-3-propan-2-yl-1,2-dihydroindene |
|---|---|
| PubChem CID | 169145342 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 3,5-dimethyl-3-propan-2-yl-1,2-dihydroindene |
| SMILES | Cc1ccc2c(c1)C(C)(C(C)C)CC2 |
| InChI | InChI=1S/C14H20/c1-10(2)14(4)8-7-12-6-5-11(3)9-13(12)14/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | LWAOFTWUMAJFIC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |