C15H22 — CID 59994805
3-butyl-3,5-dimethyl-1,2-dihydroindene (PubChem CID 59994805) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-butyl-3,5-dimethyl-1,2-dihydroindene.
| Compound Name | 3-butyl-3,5-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 59994805 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3-butyl-3,5-dimethyl-1,2-dihydroindene |
| SMILES | CCCCC1(C)CCc2ccc(C)cc21 |
| InChI | InChI=1S/C15H22/c1-4-5-9-15(3)10-8-13-7-6-12(2)11-14(13)15/h6-7,11H,4-5,8-10H2,1-3H3 |
| InChIKey | NSSIXEJYJDYZRR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |