C12H15Cl — CID 175734944
3-(1-chloroethyl)-3-methyl-1,2-dihydroindene (PubChem CID 175734944) has the molecular formula C12H15Cl and a molecular weight of 194.71 g/mol. Its IUPAC name is 3-(1-chloroethyl)-3-methyl-1,2-dihydroindene.
| Compound Name | 3-(1-chloroethyl)-3-methyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 175734944 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.71 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-(1-chloroethyl)-3-methyl-1,2-dihydroindene |
| SMILES | CC(Cl)C1(C)CCc2ccccc21 |
| InChI | InChI=1S/C12H15Cl/c1-9(13)12(2)8-7-10-5-3-4-6-11(10)12/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | GTJIJDZXBSKHQT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|