C9H8ClF — CID 13405902
3-chloro-3-fluoro-1,2-dihydroindene (PubChem CID 13405902) has the molecular formula C9H8ClF and a molecular weight of 170.61 g/mol. Its IUPAC name is 3-chloro-3-fluoro-1,2-dihydroindene.
| Compound Name | 3-chloro-3-fluoro-1,2-dihydroindene |
|---|---|
| PubChem CID | 13405902 |
| Molecular Formula | C9H8ClF |
| Molecular Weight | 170.61 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 3-chloro-3-fluoro-1,2-dihydroindene |
| SMILES | FC1(Cl)CCc2ccccc21 |
| InChI | InChI=1S/C9H8ClF/c10-9(11)6-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2 |
| InChIKey | WQVNYJNLQUHPTD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|