About 3-chloro-3-fluoro-1,2-dihydroindene
3-chloro-3-fluoro-1,2-dihydroindene (PubChem CID 13405902) has the molecular formula C9H8ClF
and a molecular weight of 170.61 g/mol. Its IUPAC name is 3-chloro-3-fluoro-1,2-dihydroindene.
Molecular Properties
| Compound Name | 3-chloro-3-fluoro-1,2-dihydroindene |
| PubChem CID | 13405902 |
| Molecular Formula | C9H8ClF |
| Molecular Weight | 170.61 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 3-chloro-3-fluoro-1,2-dihydroindene |
| SMILES | FC1(Cl)CCc2ccccc21 |
| InChI | InChI=1S/C9H8ClF/c10-9(11)6-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2 |
| InChIKey | WQVNYJNLQUHPTD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-3-fluoro-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-3-fluoro-1,2-dihydroindene?
The IUPAC name of 3-chloro-3-fluoro-1,2-dihydroindene (CID 13405902) is 3-chloro-3-fluoro-1,2-dihydroindene.
What is the SMILES notation for 3-chloro-3-fluoro-1,2-dihydroindene?
The canonical SMILES for 3-chloro-3-fluoro-1,2-dihydroindene is FC1(Cl)CCc2ccccc21.
What is the InChIKey of 3-chloro-3-fluoro-1,2-dihydroindene?
The InChIKey is WQVNYJNLQUHPTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF/c10-9(11)6-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2.
What are the key properties of 3-chloro-3-fluoro-1,2-dihydroindene?
3-chloro-3-fluoro-1,2-dihydroindene has a molecular weight of 170.61 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-3-fluoro-1,2-dihydroindene is sourced from PubChem (CID 13405902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).