C13H20O — CID 90872603
ethane;1-ethyl-2,3-dihydroinden-1-ol (PubChem CID 90872603) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is ethane;1-ethyl-2,3-dihydroinden-1-ol.
| Compound Name | ethane;1-ethyl-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 90872603 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | ethane;1-ethyl-2,3-dihydroinden-1-ol |
| SMILES | CC.CCC1(O)CCc2ccccc21 |
| InChI | InChI=1S/C11H14O.C2H6/c1-2-11(12)8-7-9-5-3-4-6-10(9)11;1-2/h3-6,12H,2,7-8H2,1H3;1-2H3 |
| InChIKey | IDPNTDQWUZSCJE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |