About ethane;1-ethyl-2,3-dihydroinden-1-ol
ethane;1-ethyl-2,3-dihydroinden-1-ol (PubChem CID 90872603) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is ethane;1-ethyl-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | ethane;1-ethyl-2,3-dihydroinden-1-ol |
| PubChem CID | 90872603 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | ethane;1-ethyl-2,3-dihydroinden-1-ol |
| SMILES | CC.CCC1(O)CCc2ccccc21 |
| InChI | InChI=1S/C11H14O.C2H6/c1-2-11(12)8-7-9-5-3-4-6-10(9)11;1-2/h3-6,12H,2,7-8H2,1H3;1-2H3 |
| InChIKey | IDPNTDQWUZSCJE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethyl-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2,3-dihydroinden-1-ol?
The IUPAC name of ethane;1-ethyl-2,3-dihydroinden-1-ol (CID 90872603) is ethane;1-ethyl-2,3-dihydroinden-1-ol.
What is the SMILES notation for ethane;1-ethyl-2,3-dihydroinden-1-ol?
The canonical SMILES for ethane;1-ethyl-2,3-dihydroinden-1-ol is CC.CCC1(O)CCc2ccccc21.
What is the InChIKey of ethane;1-ethyl-2,3-dihydroinden-1-ol?
The InChIKey is IDPNTDQWUZSCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C2H6/c1-2-11(12)8-7-9-5-3-4-6-10(9)11;1-2/h3-6,12H,2,7-8H2,1H3;1-2H3.
What are the key properties of ethane;1-ethyl-2,3-dihydroinden-1-ol?
ethane;1-ethyl-2,3-dihydroinden-1-ol has a molecular weight of 192.30 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2,3-dihydroinden-1-ol is sourced from PubChem (CID 90872603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).