C11H12O — CID 84618292
spiro[1,2-dihydroindene-3,2'-oxetane] (PubChem CID 84618292) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,2'-oxetane].
| Compound Name | spiro[1,2-dihydroindene-3,2'-oxetane] |
|---|---|
| PubChem CID | 84618292 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | spiro[1,2-dihydroindene-3,2'-oxetane] |
| SMILES | c1ccc2c(c1)CCC21CCO1 |
| InChI | InChI=1S/C11H12O/c1-2-4-10-9(3-1)5-6-11(10)7-8-12-11/h1-4H,5-8H2 |
| InChIKey | LLFAZNQHCKYNNH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |