About 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde
2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde (PubChem CID 174848722) has the molecular formula C11H9FO2
and a molecular weight of 192.19 g/mol. Its IUPAC name is 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde.
Molecular Properties
| Compound Name | 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde |
| PubChem CID | 174848722 |
| Molecular Formula | C11H9FO2 |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1(F)CCc2ccccc21 |
| InChI | InChI=1S/C11H9FO2/c12-11(10(14)7-13)6-5-8-3-1-2-4-9(8)11/h1-4,7H,5-6H2 |
| InChIKey | QGYYIWYVHWZDEH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde?
The IUPAC name of 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde (CID 174848722) is 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde.
What is the SMILES notation for 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde?
The canonical SMILES for 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde is O=CC(=O)C1(F)CCc2ccccc21.
What is the InChIKey of 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde?
The InChIKey is QGYYIWYVHWZDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FO2/c12-11(10(14)7-13)6-5-8-3-1-2-4-9(8)11/h1-4,7H,5-6H2.
What are the key properties of 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde?
2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde has a molecular weight of 192.19 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluoro-2,3-dihydroinden-1-yl)-2-oxoacetaldehyde is sourced from PubChem (CID 174848722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).