C14H21N — CID 142037175
propane;2,3,5-trimethyl-3H-indole (PubChem CID 142037175) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is propane;2,3,5-trimethyl-3H-indole.
| Compound Name | propane;2,3,5-trimethyl-3H-indole |
|---|---|
| PubChem CID | 142037175 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | propane;2,3,5-trimethyl-3H-indole |
| SMILES | CC1=Nc2ccc(C)cc2C1C.CCC |
| InChI | InChI=1S/C11H13N.C3H8/c1-7-4-5-11-10(6-7)8(2)9(3)12-11;1-3-2/h4-6,8H,1-3H3;3H2,1-2H3 |
| InChIKey | MIKJVGIVJZVAGW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |