C17H28 — CID 143829335
propane;1,2,4,7-tetramethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 143829335) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is propane;1,2,4,7-tetramethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | propane;1,2,4,7-tetramethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 143829335 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | propane;1,2,4,7-tetramethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCC.Cc1ccc2c(c1)C(C)C(C)CC2C |
| InChI | InChI=1S/C14H20.C3H8/c1-9-5-6-13-11(3)8-10(2)12(4)14(13)7-9;1-3-2/h5-7,10-12H,8H2,1-4H3;3H2,1-2H3 |
| InChIKey | MWRIANBJTCVKAF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |