C15H21I — CID 24806500
(1S,4S)-4-[(2S)-1-iodopropan-2-yl]-1,6-dimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 24806500) has the molecular formula C15H21I and a molecular weight of 328.24 g/mol. Its IUPAC name is (1S,4S)-4-[(2S)-1-iodopropan-2-yl]-1,6-dimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,4S)-4-[(2S)-1-iodopropan-2-yl]-1,6-dimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 24806500 |
| Molecular Formula | C15H21I |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (1S,4S)-4-[(2S)-1-iodopropan-2-yl]-1,6-dimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc2c(c1)[C@H]([C@H](C)CI)CC[C@@H]2C |
| InChI | InChI=1S/C15H21I/c1-10-4-6-13-11(2)5-7-14(12(3)9-16)15(13)8-10/h4,6,8,11-12,14H,5,7,9H2,1-3H3/t11-,12+,14-/m0/s1 |
| InChIKey | JSKYPTHKCJPEIC-SCRDCRAPSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|