C20H24S2 — CID 139313158
5-(3,5-dimethyl-2,3-dihydro-1H-inden-1-yl)-2,4,6-trimethylbenzene-1,3-dithiol (PubChem CID 139313158) has the molecular formula C20H24S2 and a molecular weight of 328.55 g/mol. Its IUPAC name is 5-(3,5-dimethyl-2,3-dihydro-1H-inden-1-yl)-2,4,6-trimethylbenzene-1,3-dithiol.
| Compound Name | 5-(3,5-dimethyl-2,3-dihydro-1H-inden-1-yl)-2,4,6-trimethylbenzene-1,3-dithiol |
|---|---|
| PubChem CID | 139313158 |
| Molecular Formula | C20H24S2 |
| Molecular Weight | 328.55 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 5-(3,5-dimethyl-2,3-dihydro-1H-inden-1-yl)-2,4,6-trimethylbenzene-1,3-dithiol |
| SMILES | Cc1ccc2c(c1)C(C)CC2c1c(C)c(S)c(C)c(S)c1C |
| InChI | InChI=1S/C20H24S2/c1-10-6-7-15-16(8-10)11(2)9-17(15)18-12(3)19(21)14(5)20(22)13(18)4/h6-8,11,17,21-22H,9H2,1-5H3 |
| InChIKey | VTBALZZPUSAQQK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|