About 2,7-dimethylacridine
2,7-dimethylacridine (PubChem CID 14490101) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 2,7-dimethylacridine.
Molecular Properties
| Compound Name | 2,7-dimethylacridine |
| PubChem CID | 14490101 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2,7-dimethylacridine |
| SMILES | Cc1ccc2nc3ccc(C)cc3cc2c1 |
| InChI | InChI=1S/C15H13N/c1-10-3-5-14-12(7-10)9-13-8-11(2)4-6-15(13)16-14/h3-9H,1-2H3 |
| InChIKey | ITLFEIRERKXAAO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylacridine?
The IUPAC name of 2,7-dimethylacridine (CID 14490101) is 2,7-dimethylacridine.
What is the SMILES notation for 2,7-dimethylacridine?
The canonical SMILES for 2,7-dimethylacridine is Cc1ccc2nc3ccc(C)cc3cc2c1.
What is the InChIKey of 2,7-dimethylacridine?
The InChIKey is ITLFEIRERKXAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N/c1-10-3-5-14-12(7-10)9-13-8-11(2)4-6-15(13)16-14/h3-9H,1-2H3.
What are the key properties of 2,7-dimethylacridine?
2,7-dimethylacridine has a molecular weight of 207.28 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylacridine is sourced from PubChem (CID 14490101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).