About ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane
ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane (PubChem CID 145053963) has the molecular formula C26H46
and a molecular weight of 358.65 g/mol. Its IUPAC name is ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane.
Molecular Properties
| Compound Name | ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane |
| PubChem CID | 145053963 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane |
| SMILES | C.CC.CC.CC.CC.CCC1c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C17H18.4C2H6.CH4/c1-4-13-16-9-11(2)5-7-14(16)15-8-6-12(3)10-17(13)15;4*1-2;/h5-10,13H,4H2,1-3H3;4*1-2H3;1H4 |
| InChIKey | JAVDDWVZLAZMGE-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane?
The IUPAC name of ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane (CID 145053963) is ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane.
What is the SMILES notation for ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane?
The canonical SMILES for ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane is C.CC.CC.CC.CC.CCC1c2cc(C)ccc2-c2ccc(C)cc21.
What is the InChIKey of ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane?
The InChIKey is JAVDDWVZLAZMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18.4C2H6.CH4/c1-4-13-16-9-11(2)5-7-14(16)15-8-6-12(3)10-17(13)15;4*1-2;/h5-10,13H,4H2,1-3H3;4*1-2H3;1H4.
What are the key properties of ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane?
ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane has a molecular weight of 358.65 g/mol, XLogP of 9.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane is sourced from PubChem (CID 145053963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).