C26H46 — CID 145053963
ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane (PubChem CID 145053963) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane.
| Compound Name | ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane |
|---|---|
| PubChem CID | 145053963 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | ethane;9-ethyl-2,7-dimethyl-9H-fluorene;methane |
| SMILES | C.CC.CC.CC.CC.CCC1c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C17H18.4C2H6.CH4/c1-4-13-16-9-11(2)5-7-14(16)15-8-6-12(3)10-17(13)15;4*1-2;/h5-10,13H,4H2,1-3H3;4*1-2H3;1H4 |
| InChIKey | JAVDDWVZLAZMGE-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |