cesium 2,7-dimethyl-9H-fluorene-9-carboxylate

C16H13CsO2 — CID 140605851

IUPACcesium 2,7-dimethyl-9H-fluorene-9-carboxylate
SMILESCc1ccc2c(c1)C(C(=O)[O-])c1cc(C)ccc1-2.[Cs+]
InChIInChI=1S/C16H14O2.Cs/c1-9-3-5-11-12-6-4-10(2)8-14(12)15(16(17)18)13(11)7-9;/h3-8,15H,1-2H3,(H,17,18);/q;+1/p-1
InChIKeyISDRTTPSPBSBEM-UHFFFAOYSA-M
MW370.18 g/mol
LogP-0.83
Rot. Bonds1

About cesium 2,7-dimethyl-9H-fluorene-9-carboxylate

cesium 2,7-dimethyl-9H-fluorene-9-carboxylate (PubChem CID 140605851) has the molecular formula C16H13CsO2 and a molecular weight of 370.18 g/mol. Its IUPAC name is cesium 2,7-dimethyl-9H-fluorene-9-carboxylate.

Molecular Properties

Compound Namecesium 2,7-dimethyl-9H-fluorene-9-carboxylate
PubChem CID140605851
Molecular FormulaC16H13CsO2
Molecular Weight370.18 g/mol
Exact Mass370.00
IUPAC Namecesium 2,7-dimethyl-9H-fluorene-9-carboxylate
SMILESCc1ccc2c(c1)C(C(=O)[O-])c1cc(C)ccc1-2.[Cs+]
InChIInChI=1S/C16H14O2.Cs/c1-9-3-5-11-12-6-4-10(2)8-14(12)15(16(17)18)13(11)7-9;/h3-8,15H,1-2H3,(H,17,18);/q;+1/p-1
InChIKeyISDRTTPSPBSBEM-UHFFFAOYSA-M
XLogP-0.83
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.18
LogP ≤ 5-0.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze cesium 2,7-dimethyl-9H-fluorene-9-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cesium 2,7-dimethyl-9H-fluorene-9-carboxylate?
The IUPAC name of cesium 2,7-dimethyl-9H-fluorene-9-carboxylate (CID 140605851) is cesium 2,7-dimethyl-9H-fluorene-9-carboxylate.
What is the SMILES notation for cesium 2,7-dimethyl-9H-fluorene-9-carboxylate?
The canonical SMILES for cesium 2,7-dimethyl-9H-fluorene-9-carboxylate is Cc1ccc2c(c1)C(C(=O)[O-])c1cc(C)ccc1-2.[Cs+].
What is the InChIKey of cesium 2,7-dimethyl-9H-fluorene-9-carboxylate?
The InChIKey is ISDRTTPSPBSBEM-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H14O2.Cs/c1-9-3-5-11-12-6-4-10(2)8-14(12)15(16(17)18)13(11)7-9;/h3-8,15H,1-2H3,(H,17,18);/q;+1/p-1.
What are the key properties of cesium 2,7-dimethyl-9H-fluorene-9-carboxylate?
cesium 2,7-dimethyl-9H-fluorene-9-carboxylate has a molecular weight of 370.18 g/mol, XLogP of -0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 2,7-dimethyl-9H-fluorene-9-carboxylate is sourced from PubChem (CID 140605851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).