C16H13CsO2 — CID 140605851
cesium 2,7-dimethyl-9H-fluorene-9-carboxylate (PubChem CID 140605851) has the molecular formula C16H13CsO2 and a molecular weight of 370.18 g/mol. Its IUPAC name is cesium 2,7-dimethyl-9H-fluorene-9-carboxylate.
| Compound Name | cesium 2,7-dimethyl-9H-fluorene-9-carboxylate |
|---|---|
| PubChem CID | 140605851 |
| Molecular Formula | C16H13CsO2 |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | cesium 2,7-dimethyl-9H-fluorene-9-carboxylate |
| SMILES | Cc1ccc2c(c1)C(C(=O)[O-])c1cc(C)ccc1-2.[Cs+] |
| InChI | InChI=1S/C16H14O2.Cs/c1-9-3-5-11-12-6-4-10(2)8-14(12)15(16(17)18)13(11)7-9;/h3-8,15H,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | ISDRTTPSPBSBEM-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |