C16H19O2- — CID 102415425
2-(3-butyl-6-methyl-1H-inden-1-yl)acetate (PubChem CID 102415425) has the molecular formula C16H19O2- and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(3-butyl-6-methyl-1H-inden-1-yl)acetate.
| Compound Name | 2-(3-butyl-6-methyl-1H-inden-1-yl)acetate |
|---|---|
| PubChem CID | 102415425 |
| Molecular Formula | C16H19O2- |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(3-butyl-6-methyl-1H-inden-1-yl)acetate |
| SMILES | CCCCC1=CC(CC(=O)[O-])c2cc(C)ccc21 |
| InChI | InChI=1S/C16H20O2/c1-3-4-5-12-9-13(10-16(17)18)15-8-11(2)6-7-14(12)15/h6-9,13H,3-5,10H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | OITSLMPKQTVEFQ-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |