C16H22O — CID 14895354
3-hexyl-5-methyl-2,3-dihydroinden-1-one (PubChem CID 14895354) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-hexyl-5-methyl-2,3-dihydroinden-1-one.
| Compound Name | 3-hexyl-5-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 14895354 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-hexyl-5-methyl-2,3-dihydroinden-1-one |
| SMILES | CCCCCCC1CC(=O)c2ccc(C)cc21 |
| InChI | InChI=1S/C16H22O/c1-3-4-5-6-7-13-11-16(17)14-9-8-12(2)10-15(13)14/h8-10,13H,3-7,11H2,1-2H3 |
| InChIKey | CRWCQDLQLBCFNR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|