C15H20O2 — CID 10955432
7-hydroxy-4-methyl-3-pentyl-2,3-dihydroinden-1-one (PubChem CID 10955432) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 7-hydroxy-4-methyl-3-pentyl-2,3-dihydroinden-1-one.
| Compound Name | 7-hydroxy-4-methyl-3-pentyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 10955432 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 7-hydroxy-4-methyl-3-pentyl-2,3-dihydroinden-1-one |
| SMILES | CCCCCC1CC(=O)c2c(O)ccc(C)c21 |
| InChI | InChI=1S/C15H20O2/c1-3-4-5-6-11-9-13(17)15-12(16)8-7-10(2)14(11)15/h7-8,11,16H,3-6,9H2,1-2H3 |
| InChIKey | XICDQCABPDASOA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|