C16H22O — CID 134983328
5-methyl-2,3-dipropyl-1H-inden-1-ol (PubChem CID 134983328) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 5-methyl-2,3-dipropyl-1H-inden-1-ol.
| Compound Name | 5-methyl-2,3-dipropyl-1H-inden-1-ol |
|---|---|
| PubChem CID | 134983328 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 5-methyl-2,3-dipropyl-1H-inden-1-ol |
| SMILES | CCCC1=C(CCC)C(O)c2ccc(C)cc21 |
| InChI | InChI=1S/C16H22O/c1-4-6-12-13(7-5-2)16(17)14-9-8-11(3)10-15(12)14/h8-10,16-17H,4-7H2,1-3H3 |
| InChIKey | WWXKJJKCRCLLKP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |