C24H22O — CID 134983672
5-methyl-2,3-bis(4-methylphenyl)-1H-inden-1-ol (PubChem CID 134983672) has the molecular formula C24H22O and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-methyl-2,3-bis(4-methylphenyl)-1H-inden-1-ol.
| Compound Name | 5-methyl-2,3-bis(4-methylphenyl)-1H-inden-1-ol |
|---|---|
| PubChem CID | 134983672 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-methyl-2,3-bis(4-methylphenyl)-1H-inden-1-ol |
| SMILES | Cc1ccc(C2=C(c3ccc(C)cc3)C(O)c3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C24H22O/c1-15-4-9-18(10-5-15)22-21-14-17(3)8-13-20(21)24(25)23(22)19-11-6-16(2)7-12-19/h4-14,24-25H,1-3H3 |
| InChIKey | QLNFFNGATJVYIO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|