C11H11ClO2 — CID 140990487
2-chloro-6-methyl-1,4-dihydronaphthalene-1,4-diol (PubChem CID 140990487) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-chloro-6-methyl-1,4-dihydronaphthalene-1,4-diol.
| Compound Name | 2-chloro-6-methyl-1,4-dihydronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 140990487 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 2-chloro-6-methyl-1,4-dihydronaphthalene-1,4-diol |
| SMILES | Cc1ccc2c(c1)C(O)C=C(Cl)C2O |
| InChI | InChI=1S/C11H11ClO2/c1-6-2-3-7-8(4-6)10(13)5-9(12)11(7)14/h2-5,10-11,13-14H,1H3 |
| InChIKey | XGVHSTQROWRUGR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |