C11H12O — CID 130220220
(3S)-3,6-dimethyl-3H-inden-1-ol (PubChem CID 130220220) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (3S)-3,6-dimethyl-3H-inden-1-ol.
| Compound Name | (3S)-3,6-dimethyl-3H-inden-1-ol |
|---|---|
| PubChem CID | 130220220 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (3S)-3,6-dimethyl-3H-inden-1-ol |
| SMILES | Cc1ccc2c(c1)C(O)=C[C@@H]2C |
| InChI | InChI=1S/C11H12O/c1-7-3-4-9-8(2)6-11(12)10(9)5-7/h3-6,8,12H,1-2H3/t8-/m0/s1 |
| InChIKey | WHKKIHDPUSHDIO-QMMMGPOBSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |