About hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol
hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol (PubChem CID 159043640) has the molecular formula C21H24O5
and a molecular weight of 356.42 g/mol. Its IUPAC name is hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol.
Molecular Properties
| Compound Name | hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol |
| PubChem CID | 159043640 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol |
| SMILES | Cc1ccc(O)c(-c2cc(C)ccc2O)c1.Cc1ccc(O)cc1.OO |
| InChI | InChI=1S/C14H14O2.C7H8O.H2O2/c1-9-3-5-13(15)11(7-9)12-8-10(2)4-6-14(12)16;1-6-2-4-7(8)5-3-6;1-2/h3-8,15-16H,1-2H3;2-5,8H,1H3;1-2H |
| InChIKey | JWJQABXELZFXFA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol?
The IUPAC name of hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol (CID 159043640) is hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol.
What is the SMILES notation for hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol?
The canonical SMILES for hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol is Cc1ccc(O)c(-c2cc(C)ccc2O)c1.Cc1ccc(O)cc1.OO.
What is the InChIKey of hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol?
The InChIKey is JWJQABXELZFXFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.C7H8O.H2O2/c1-9-3-5-13(15)11(7-9)12-8-10(2)4-6-14(12)16;1-6-2-4-7(8)5-3-6;1-2/h3-8,15-16H,1-2H3;2-5,8H,1H3;1-2H.
What are the key properties of hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol?
hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol has a molecular weight of 356.42 g/mol, XLogP of 5.10, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;2-(2-hydroxy-5-methylphenyl)-4-methylphenol;4-methylphenol is sourced from PubChem (CID 159043640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).