C17H14 — CID 143619710
5,10-dimethyltetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2(7),3,5,8,11,13-heptaene (PubChem CID 143619710) has the molecular formula C17H14 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5,10-dimethyltetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2(7),3,5,8,11,13-heptaene.
| Compound Name | 5,10-dimethyltetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2(7),3,5,8,11,13-heptaene |
|---|---|
| PubChem CID | 143619710 |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 5,10-dimethyltetracyclo[6.6.1.02,7.011,15]pentadeca-1(15),2(7),3,5,8,11,13-heptaene |
| SMILES | Cc1ccc2c(c1)C1=CC(C)c3cccc-2c31 |
| InChI | InChI=1S/C17H14/c1-10-6-7-13-14-5-3-4-12-11(2)9-16(17(12)14)15(13)8-10/h3-9,11H,1-2H3 |
| InChIKey | SSHVLOQKONCDNM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |