C21H20Si — CID 171436554
4,14,14-trimethyl-14-silatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2(7),3,5,8,10,12,15,17-nonaene (PubChem CID 171436554) has the molecular formula C21H20Si and a molecular weight of 300.48 g/mol. Its IUPAC name is 4,14,14-trimethyl-14-silatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2(7),3,5,8,10,12,15,17-nonaene.
| Compound Name | 4,14,14-trimethyl-14-silatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2(7),3,5,8,10,12,15,17-nonaene |
|---|---|
| PubChem CID | 171436554 |
| Molecular Formula | C21H20Si |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4,14,14-trimethyl-14-silatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2(7),3,5,8,10,12,15,17-nonaene |
| SMILES | Cc1ccc2c(c1)-c1ccccc1[Si](C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C21H20Si/c1-15-12-13-16-17-8-4-6-10-20(17)22(2,3)21-11-7-5-9-18(21)19(16)14-15/h4-14H,1-3H3 |
| InChIKey | YESBQGOVFWGLTD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|